C17H24N2O4S — CID 9496224
1-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]pentane-1,4-dione (PubChem CID 9496224) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]pentane-1,4-dione.
| Compound Name | 1-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]pentane-1,4-dione |
|---|---|
| PubChem CID | 9496224 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)N1CCN(S(=O)(=O)c2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C17H24N2O4S/c1-13-4-5-14(2)16(12-13)24(22,23)19-10-8-18(9-11-19)17(21)7-6-15(3)20/h4-5,12H,6-11H2,1-3H3 |
| InChIKey | JSAOTSWBFFTFSV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |