C21H21N3 — CID 94962258
1-(3-methylphenyl)-5-[4-(2-methylpropyl)phenyl]pyrazole-3-carbonitrile (PubChem CID 94962258) has the molecular formula C21H21N3 and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-(3-methylphenyl)-5-[4-(2-methylpropyl)phenyl]pyrazole-3-carbonitrile.
| Compound Name | 1-(3-methylphenyl)-5-[4-(2-methylpropyl)phenyl]pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 94962258 |
| Molecular Formula | C21H21N3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-(3-methylphenyl)-5-[4-(2-methylpropyl)phenyl]pyrazole-3-carbonitrile |
| SMILES | Cc1cccc(-n2nc(C#N)cc2-c2ccc(CC(C)C)cc2)c1 |
| InChI | InChI=1S/C21H21N3/c1-15(2)11-17-7-9-18(10-8-17)21-13-19(14-22)23-24(21)20-6-4-5-16(3)12-20/h4-10,12-13,15H,11H2,1-3H3 |
| InChIKey | KFHJFOZGWUQOSN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |