C7H7Cl3N6S — CID 94962754
[1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(trichloromethyl)triazol-4-yl]methanamine (PubChem CID 94962754) has the molecular formula C7H7Cl3N6S and a molecular weight of 313.60 g/mol. Its IUPAC name is [1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(trichloromethyl)triazol-4-yl]methanamine.
| Compound Name | [1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(trichloromethyl)triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 94962754 |
| Molecular Formula | C7H7Cl3N6S |
| Molecular Weight | 313.60 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | [1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(trichloromethyl)triazol-4-yl]methanamine |
| SMILES | Cc1nnc(-n2nnc(CN)c2C(Cl)(Cl)Cl)s1 |
| InChI | InChI=1S/C7H7Cl3N6S/c1-3-12-14-6(17-3)16-5(7(8,9)10)4(2-11)13-15-16/h2,11H2,1H3 |
| InChIKey | ICFBXCWVOKSPJD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.60 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|