About [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol
[1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol (PubChem CID 94962827) has the molecular formula C11H11N5O2S2
and a molecular weight of 309.38 g/mol. Its IUPAC name is [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol |
| PubChem CID | 94962827 |
| Molecular Formula | C11H11N5O2S2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol |
| SMILES | COCc1nnc(-n2nnc(CO)c2-c2cccs2)s1 |
| InChI | InChI=1S/C11H11N5O2S2/c1-18-6-9-13-14-11(20-9)16-10(7(5-17)12-15-16)8-3-2-4-19-8/h2-4,17H,5-6H2,1H3 |
| InChIKey | VYSQODGHLRQMOZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol?
The IUPAC name of [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol (CID 94962827) is [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol.
What is the SMILES notation for [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol?
The canonical SMILES for [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol is COCc1nnc(-n2nnc(CO)c2-c2cccs2)s1.
What is the InChIKey of [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol?
The InChIKey is VYSQODGHLRQMOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5O2S2/c1-18-6-9-13-14-11(20-9)16-10(7(5-17)12-15-16)8-3-2-4-19-8/h2-4,17H,5-6H2,1H3.
What are the key properties of [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol?
[1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol has a molecular weight of 309.38 g/mol, XLogP of 1.49, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-5-thiophen-2-yltriazol-4-yl]methanol is sourced from PubChem (CID 94962827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).