About (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile
(2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile (PubChem CID 949664) has the molecular formula C20H15N5
and a molecular weight of 325.38 g/mol. Its IUPAC name is (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile.
Molecular Properties
| Compound Name | (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile |
| PubChem CID | 949664 |
| Molecular Formula | C20H15N5 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile |
| SMILES | Cc1cccc(N2C(N)=C(C#N)C(C#N)(C#N)[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C20H15N5/c1-14-6-5-9-16(10-14)25-18(15-7-3-2-4-8-15)20(12-22,13-23)17(11-21)19(25)24/h2-10,18H,24H2,1H3/t18-/m1/s1 |
| InChIKey | SNTJIIZCJXPGLE-GOSISDBHSA-N |
| XLogP | 3.28 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile?
The IUPAC name of (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile (CID 949664) is (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile.
What is the SMILES notation for (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile?
The canonical SMILES for (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile is Cc1cccc(N2C(N)=C(C#N)C(C#N)(C#N)[C@H]2c2ccccc2)c1.
What is the InChIKey of (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile?
The InChIKey is SNTJIIZCJXPGLE-GOSISDBHSA-N. The full InChI is InChI=1S/C20H15N5/c1-14-6-5-9-16(10-14)25-18(15-7-3-2-4-8-15)20(12-22,13-23)17(11-21)19(25)24/h2-10,18H,24H2,1H3/t18-/m1/s1.
What are the key properties of (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile?
(2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile has a molecular weight of 325.38 g/mol, XLogP of 3.28, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-amino-1-(3-methylphenyl)-2-phenyl-2H-pyrrole-3,3,4-tricarbonitrile is sourced from PubChem (CID 949664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).