About (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one
(2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 94975892) has the molecular formula C9H7F2NO2
and a molecular weight of 199.16 g/mol. Its IUPAC name is (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one |
| PubChem CID | 94975892 |
| Molecular Formula | C9H7F2NO2 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | C[C@H]1Oc2c(F)cc(F)cc2NC1=O |
| InChI | InChI=1S/C9H7F2NO2/c1-4-9(13)12-7-3-5(10)2-6(11)8(7)14-4/h2-4H,1H3,(H,12,13)/t4-/m1/s1 |
| InChIKey | WYIJQRKXTODEEC-SCSAIBSYSA-N |
| XLogP | 1.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one?
The IUPAC name of (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one (CID 94975892) is (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one?
The canonical SMILES for (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one is C[C@H]1Oc2c(F)cc(F)cc2NC1=O.
What is the InChIKey of (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one?
The InChIKey is WYIJQRKXTODEEC-SCSAIBSYSA-N. The full InChI is InChI=1S/C9H7F2NO2/c1-4-9(13)12-7-3-5(10)2-6(11)8(7)14-4/h2-4H,1H3,(H,12,13)/t4-/m1/s1.
What are the key properties of (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one?
(2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one has a molecular weight of 199.16 g/mol, XLogP of 1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-6,8-difluoro-2-methyl-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 94975892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).