C31H26Cl2N2 — CID 9497703
1-(2,4-dichlorophenyl)-N-[(4S,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]methanimine (PubChem CID 9497703) has the molecular formula C31H26Cl2N2 and a molecular weight of 497.47 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[(4S,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]methanimine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[(4S,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]methanimine |
|---|---|
| PubChem CID | 9497703 |
| Molecular Formula | C31H26Cl2N2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[(4S,10S)-4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]methanimine |
| SMILES | Clc1ccc(/C=N/c2cc3c4c(c2)[C@H](c2ccccc2)CCN4CC[C@H]3c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C31H26Cl2N2/c32-24-12-11-23(30(33)17-24)20-34-25-18-28-26(21-7-3-1-4-8-21)13-15-35-16-14-27(29(19-25)31(28)35)22-9-5-2-6-10-22/h1-12,17-20,26-27H,13-16H2/b34-20+/t26-,27-/m0/s1 |
| InChIKey | DSXWXGIVOXEDKP-JGGYJDQWSA-N |
| XLogP | 8.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|