C30H23ClN2O2 — CID 9497835
2-(4-chlorophenyl)-6,8-dimethyl-N-(4-phenoxyphenyl)quinoline-4-carboxamide (PubChem CID 9497835) has the molecular formula C30H23ClN2O2 and a molecular weight of 478.98 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6,8-dimethyl-N-(4-phenoxyphenyl)quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-6,8-dimethyl-N-(4-phenoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 9497835 |
| Molecular Formula | C30H23ClN2O2 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-(4-chlorophenyl)-6,8-dimethyl-N-(4-phenoxyphenyl)quinoline-4-carboxamide |
| SMILES | Cc1cc(C)c2nc(-c3ccc(Cl)cc3)cc(C(=O)Nc3ccc(Oc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C30H23ClN2O2/c1-19-16-20(2)29-26(17-19)27(18-28(33-29)21-8-10-22(31)11-9-21)30(34)32-23-12-14-25(15-13-23)35-24-6-4-3-5-7-24/h3-18H,1-2H3,(H,32,34) |
| InChIKey | UGPCWXGDQWATOS-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |