About 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol
2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol (PubChem CID 949785) has the molecular formula C13H9N3O2S
and a molecular weight of 271.30 g/mol. Its IUPAC name is 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol.
Molecular Properties
| Compound Name | 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol |
| PubChem CID | 949785 |
| Molecular Formula | C13H9N3O2S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol |
| SMILES | Oc1oc(-c2ccccc2)nc1C=Nc1nccs1 |
| InChI | InChI=1S/C13H9N3O2S/c17-12-10(8-15-13-14-6-7-19-13)16-11(18-12)9-4-2-1-3-5-9/h1-8,17H |
| InChIKey | UGUIPEONHVWAJQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol?
The IUPAC name of 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol (CID 949785) is 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol.
What is the SMILES notation for 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol?
The canonical SMILES for 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol is Oc1oc(-c2ccccc2)nc1C=Nc1nccs1.
What is the InChIKey of 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol?
The InChIKey is UGUIPEONHVWAJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O2S/c17-12-10(8-15-13-14-6-7-19-13)16-11(18-12)9-4-2-1-3-5-9/h1-8,17H.
What are the key properties of 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol?
2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol has a molecular weight of 271.30 g/mol, XLogP of 3.25, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4-(1,3-thiazol-2-yliminomethyl)-1,3-oxazol-5-ol is sourced from PubChem (CID 949785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).