About 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole
5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole (PubChem CID 94980518) has the molecular formula C13H6Cl2FNO
and a molecular weight of 282.10 g/mol. Its IUPAC name is 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole |
| PubChem CID | 94980518 |
| Molecular Formula | C13H6Cl2FNO |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole |
| SMILES | Fc1ccc(-c2nc3cc(Cl)cc(Cl)c3o2)cc1 |
| InChI | InChI=1S/C13H6Cl2FNO/c14-8-5-10(15)12-11(6-8)17-13(18-12)7-1-3-9(16)4-2-7/h1-6H |
| InChIKey | NJSGPZNKHHPABG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole?
The IUPAC name of 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole (CID 94980518) is 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole.
What is the SMILES notation for 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole?
The canonical SMILES for 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole is Fc1ccc(-c2nc3cc(Cl)cc(Cl)c3o2)cc1.
What is the InChIKey of 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole?
The InChIKey is NJSGPZNKHHPABG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6Cl2FNO/c14-8-5-10(15)12-11(6-8)17-13(18-12)7-1-3-9(16)4-2-7/h1-6H.
What are the key properties of 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole?
5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole has a molecular weight of 282.10 g/mol, XLogP of 4.94, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-2-(4-fluorophenyl)-1,3-benzoxazole is sourced from PubChem (CID 94980518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).