C8H15F3N2 — CID 94983103
(2S,5R)-2,5-dimethyl-1-(2,2,2-trifluoroethyl)piperazine (PubChem CID 94983103) has the molecular formula C8H15F3N2 and a molecular weight of 196.22 g/mol. Its IUPAC name is (2S,5R)-2,5-dimethyl-1-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | (2S,5R)-2,5-dimethyl-1-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 94983103 |
| Molecular Formula | C8H15F3N2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (2S,5R)-2,5-dimethyl-1-(2,2,2-trifluoroethyl)piperazine |
| SMILES | C[C@@H]1CN(CC(F)(F)F)[C@@H](C)CN1 |
| InChI | InChI=1S/C8H15F3N2/c1-6-4-13(5-8(9,10)11)7(2)3-12-6/h6-7,12H,3-5H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | NLLHLVKHFIWMIW-RQJHMYQMSA-N |
| XLogP | 1.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |