C28H46O7 — CID 9498363
diethyl (1S,5S)-1,3,5,7-tetratert-butyl-2,6,9-trioxabicyclo[3.3.1]nona-3,7-diene-4,8-dicarboxylate (PubChem CID 9498363) has the molecular formula C28H46O7 and a molecular weight of 494.67 g/mol. Its IUPAC name is diethyl (1S,5S)-1,3,5,7-tetratert-butyl-2,6,9-trioxabicyclo[3.3.1]nona-3,7-diene-4,8-dicarboxylate.
| Compound Name | diethyl (1S,5S)-1,3,5,7-tetratert-butyl-2,6,9-trioxabicyclo[3.3.1]nona-3,7-diene-4,8-dicarboxylate |
|---|---|
| PubChem CID | 9498363 |
| Molecular Formula | C28H46O7 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | diethyl (1S,5S)-1,3,5,7-tetratert-butyl-2,6,9-trioxabicyclo[3.3.1]nona-3,7-diene-4,8-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(C)(C)C)O[C@@]2(C(C)(C)C)O[C@]1(C(C)(C)C)OC(C(C)(C)C)=C2C(=O)OCC |
| InChI | InChI=1S/C28H46O7/c1-15-31-21(29)17-19(23(3,4)5)33-28(26(12,13)14)18(22(30)32-16-2)20(24(6,7)8)34-27(17,35-28)25(9,10)11/h15-16H2,1-14H3/t27-,28-/m1/s1 |
| InChIKey | ACGVLRHQSNEIGM-VSGBNLITSA-N |
| XLogP | 6.27 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |