C17H28F3NO — CID 9498579
N-[(E,1R)-1-cyclohexylnon-2-enyl]-2,2,2-trifluoroacetamide (PubChem CID 9498579) has the molecular formula C17H28F3NO and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[(E,1R)-1-cyclohexylnon-2-enyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(E,1R)-1-cyclohexylnon-2-enyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 9498579 |
| Molecular Formula | C17H28F3NO |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N-[(E,1R)-1-cyclohexylnon-2-enyl]-2,2,2-trifluoroacetamide |
| SMILES | CCCCCC/C=C/[C@H](NC(=O)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C17H28F3NO/c1-2-3-4-5-6-10-13-15(14-11-8-7-9-12-14)21-16(22)17(18,19)20/h10,13-15H,2-9,11-12H2,1H3,(H,21,22)/b13-10+/t15-/m0/s1 |
| InChIKey | SSGXICUYACVZAB-VOMSXAGXSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|