C11H7ClF3N3 — CID 949932
2-N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)benzene-1,2-diamine (PubChem CID 949932) has the molecular formula C11H7ClF3N3 and a molecular weight of 273.65 g/mol. Its IUPAC name is 2-N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)benzene-1,2-diamine.
| Compound Name | 2-N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 949932 |
| Molecular Formula | C11H7ClF3N3 |
| Molecular Weight | 273.65 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-N-(3-chloro-2,5,6-trifluoro-4-pyridinyl)benzene-1,2-diamine |
| SMILES | Nc1ccccc1Nc1c(F)c(F)nc(F)c1Cl |
| InChI | InChI=1S/C11H7ClF3N3/c12-7-9(8(13)11(15)18-10(7)14)17-6-4-2-1-3-5(6)16/h1-4H,16H2,(H,17,18) |
| InChIKey | AFGHSLBAQYZGPG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|