C29H25Cl3N3O2+ — CID 9499479
2-[(2-carboxy-5,7-dichloroquinolin-4-yl)amino]ethyl-[[(2R)-5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]methyl]-methylazanium (PubChem CID 9499479) has the molecular formula C29H25Cl3N3O2+ and a molecular weight of 553.90 g/mol. Its IUPAC name is 2-[(2-carboxy-5,7-dichloroquinolin-4-yl)amino]ethyl-[[(2R)-5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]methyl]-methylazanium.
| Compound Name | 2-[(2-carboxy-5,7-dichloroquinolin-4-yl)amino]ethyl-[[(2R)-5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]methyl]-methylazanium |
|---|---|
| PubChem CID | 9499479 |
| Molecular Formula | C29H25Cl3N3O2+ |
| Molecular Weight | 553.90 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | 2-[(2-carboxy-5,7-dichloroquinolin-4-yl)amino]ethyl-[[(2R)-5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]methyl]-methylazanium |
| SMILES | C[NH+](CCNc1cc(C(=O)O)nc2cc(Cl)cc(Cl)c12)C[C@@H]1c2ccccc2C=Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C29H24Cl3N3O2/c1-35(11-10-33-25-15-27(29(36)37)34-26-14-20(31)13-24(32)28(25)26)16-23-21-5-3-2-4-17(21)6-7-18-8-9-19(30)12-22(18)23/h2-9,12-15,23H,10-11,16H2,1H3,(H,33,34)(H,36,37)/p+1/t23-/m1/s1 |
| InChIKey | JFLYSIPPKAVENU-HSZRJFAPSA-O |
| XLogP | 6.14 |
| TPSA | 66.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.90 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|