C35H28N3O4+ — CID 9499858
(2S,6S,8R,12S)-13-methyl-1,4,7,10-tetraphenyl-4,10-diaza-13-azoniatetracyclo[5.5.1.02,6.08,12]tridecane-3,5,9,11-tetrone (PubChem CID 9499858) has the molecular formula C35H28N3O4+ and a molecular weight of 554.63 g/mol. Its IUPAC name is (2S,6S,8R,12S)-13-methyl-1,4,7,10-tetraphenyl-4,10-diaza-13-azoniatetracyclo[5.5.1.02,6.08,12]tridecane-3,5,9,11-tetrone.
| Compound Name | (2S,6S,8R,12S)-13-methyl-1,4,7,10-tetraphenyl-4,10-diaza-13-azoniatetracyclo[5.5.1.02,6.08,12]tridecane-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 9499858 |
| Molecular Formula | C35H28N3O4+ |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | (2S,6S,8R,12S)-13-methyl-1,4,7,10-tetraphenyl-4,10-diaza-13-azoniatetracyclo[5.5.1.02,6.08,12]tridecane-3,5,9,11-tetrone |
| SMILES | C[NH+]1C2(c3ccccc3)[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3C1(c1ccccc1)[C@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C35H27N3O4/c1-36-34(22-14-6-2-7-15-22)26-28(32(41)37(30(26)39)24-18-10-4-11-19-24)35(36,23-16-8-3-9-17-23)29-27(34)31(40)38(33(29)42)25-20-12-5-13-21-25/h2-21,26-29H,1H3/p+1/t26-,27-,28-,29+,34?,35?/m1/s1 |
| InChIKey | CVXAESRWEMSDTL-FUZVJHSHSA-O |
| XLogP | 2.93 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|