C17H16ClN3S — CID 949991
(1S)-1-(2-chlorophenyl)-2-phenyl-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazole-3-thione (PubChem CID 949991) has the molecular formula C17H16ClN3S and a molecular weight of 329.86 g/mol. Its IUPAC name is (1S)-1-(2-chlorophenyl)-2-phenyl-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazole-3-thione.
| Compound Name | (1S)-1-(2-chlorophenyl)-2-phenyl-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazole-3-thione |
|---|---|
| PubChem CID | 949991 |
| Molecular Formula | C17H16ClN3S |
| Molecular Weight | 329.86 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | (1S)-1-(2-chlorophenyl)-2-phenyl-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazole-3-thione |
| SMILES | S=C1N(c2ccccc2)[C@H](c2ccccc2Cl)N2CCCN12 |
| InChI | InChI=1S/C17H16ClN3S/c18-15-10-5-4-9-14(15)16-19-11-6-12-20(19)17(22)21(16)13-7-2-1-3-8-13/h1-5,7-10,16H,6,11-12H2/t16-/m1/s1 |
| InChIKey | QISSZKUTKJUFEM-MRXNPFEDSA-N |
| XLogP | 4.07 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.86 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|