C17H24BrN3O2 — CID 95021250
[(1R)-1-(3-bromophenyl)-3-[(4R)-4-methylazepan-1-yl]-3-oxopropyl]urea (PubChem CID 95021250) has the molecular formula C17H24BrN3O2 and a molecular weight of 382.30 g/mol. Its IUPAC name is [(1R)-1-(3-bromophenyl)-3-[(4R)-4-methylazepan-1-yl]-3-oxopropyl]urea.
| Compound Name | [(1R)-1-(3-bromophenyl)-3-[(4R)-4-methylazepan-1-yl]-3-oxopropyl]urea |
|---|---|
| PubChem CID | 95021250 |
| Molecular Formula | C17H24BrN3O2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | [(1R)-1-(3-bromophenyl)-3-[(4R)-4-methylazepan-1-yl]-3-oxopropyl]urea |
| SMILES | C[C@@H]1CCCN(C(=O)C[C@@H](NC(N)=O)c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C17H24BrN3O2/c1-12-4-3-8-21(9-7-12)16(22)11-15(20-17(19)23)13-5-2-6-14(18)10-13/h2,5-6,10,12,15H,3-4,7-9,11H2,1H3,(H3,19,20,23)/t12-,15-/m1/s1 |
| InChIKey | AUENOKKQRSEOHT-IUODEOHRSA-N |
| XLogP | 3.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |