C16H12N4S2 — CID 950249
2-(1,3-benzothiazol-2-yl)-3-(3-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 950249) has the molecular formula C16H12N4S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-(3-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-(3-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 950249 |
| Molecular Formula | C16H12N4S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-(3-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cccc(-c2nc(=S)[nH]n2-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C16H12N4S2/c1-10-5-4-6-11(9-10)14-18-15(21)19-20(14)16-17-12-7-2-3-8-13(12)22-16/h2-9H,1H3,(H,19,21) |
| InChIKey | LWJUSPUGUPUBTB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|