C18H26N4O3 — CID 95032730
1-[2-(3-methoxyphenoxy)ethyl]-3-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea (PubChem CID 95032730) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[2-(3-methoxyphenoxy)ethyl]-3-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-[2-(3-methoxyphenoxy)ethyl]-3-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 95032730 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[2-(3-methoxyphenoxy)ethyl]-3-[(1R)-1-(1,3,5-trimethylpyrazol-4-yl)ethyl]urea |
| SMILES | COc1cccc(OCCNC(=O)N[C@H](C)c2c(C)nn(C)c2C)c1 |
| InChI | InChI=1S/C18H26N4O3/c1-12(17-13(2)21-22(4)14(17)3)20-18(23)19-9-10-25-16-8-6-7-15(11-16)24-5/h6-8,11-12H,9-10H2,1-5H3,(H2,19,20,23)/t12-/m1/s1 |
| InChIKey | HQERCRRDXSXXNU-GFCCVEGCSA-N |
| XLogP | 2.48 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|