C3HBrF6 — CID 95036254
(2S)-1-bromo-1,1,2,3,3,3-hexafluoropropane (PubChem CID 95036254) has the molecular formula C3HBrF6 and a molecular weight of 230.93 g/mol. Its IUPAC name is (2S)-1-bromo-1,1,2,3,3,3-hexafluoropropane.
| Compound Name | (2S)-1-bromo-1,1,2,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 95036254 |
| Molecular Formula | C3HBrF6 |
| Molecular Weight | 230.93 g/mol |
| Exact Mass | 229.92 |
| IUPAC Name | (2S)-1-bromo-1,1,2,3,3,3-hexafluoropropane |
| SMILES | F[C@@H](C(F)(F)F)C(F)(F)Br |
| InChI | InChI=1S/C3HBrF6/c4-2(6,7)1(5)3(8,9)10/h1H/t1-/m1/s1 |
| InChIKey | UBSZSCBAJXCXOO-PVQJCKRUSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.93 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|