C4Br2Cl2F6 — CID 95036366
(1S,3R)-1,3-dibromo-1,4-dichloro-1,2,2,3,4,4-hexafluorobutane (PubChem CID 95036366) has the molecular formula C4Br2Cl2F6 and a molecular weight of 392.75 g/mol. Its IUPAC name is (1S,3R)-1,3-dibromo-1,4-dichloro-1,2,2,3,4,4-hexafluorobutane.
| Compound Name | (1S,3R)-1,3-dibromo-1,4-dichloro-1,2,2,3,4,4-hexafluorobutane |
|---|---|
| PubChem CID | 95036366 |
| Molecular Formula | C4Br2Cl2F6 |
| Molecular Weight | 392.75 g/mol |
| Exact Mass | 389.76 |
| IUPAC Name | (1S,3R)-1,3-dibromo-1,4-dichloro-1,2,2,3,4,4-hexafluorobutane |
| SMILES | FC(F)(Cl)[C@](F)(Br)C(F)(F)[C@](F)(Cl)Br |
| InChI | InChI=1S/C4Br2Cl2F6/c5-1(9,4(8,13)14)2(10,11)3(6,7)12/t1-,3+/m0/s1 |
| InChIKey | CNQPZAGOLNLMLO-BIZFKFMOSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.75 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|