C4HBr2ClF6 — CID 95036369
(2S,3R)-2,3-dibromo-2-chloro-1,1,1,4,4,4-hexafluorobutane (PubChem CID 95036369) has the molecular formula C4HBr2ClF6 and a molecular weight of 358.30 g/mol. Its IUPAC name is (2S,3R)-2,3-dibromo-2-chloro-1,1,1,4,4,4-hexafluorobutane.
| Compound Name | (2S,3R)-2,3-dibromo-2-chloro-1,1,1,4,4,4-hexafluorobutane |
|---|---|
| PubChem CID | 95036369 |
| Molecular Formula | C4HBr2ClF6 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 355.80 |
| IUPAC Name | (2S,3R)-2,3-dibromo-2-chloro-1,1,1,4,4,4-hexafluorobutane |
| SMILES | FC(F)(F)[C@@H](Br)[C@@](Cl)(Br)C(F)(F)F |
| InChI | InChI=1S/C4HBr2ClF6/c5-1(3(8,9)10)2(6,7)4(11,12)13/h1H/t1-,2-/m0/s1 |
| InChIKey | ZMYHDNKORPYGEM-LWMBPPNESA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|