C20H23N3O3 — CID 95042437
6-[(2S)-2-(4-methoxyphenyl)azepane-1-carbonyl]pyridine-3-carboxamide (PubChem CID 95042437) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 6-[(2S)-2-(4-methoxyphenyl)azepane-1-carbonyl]pyridine-3-carboxamide.
| Compound Name | 6-[(2S)-2-(4-methoxyphenyl)azepane-1-carbonyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95042437 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 6-[(2S)-2-(4-methoxyphenyl)azepane-1-carbonyl]pyridine-3-carboxamide |
| SMILES | COc1ccc([C@@H]2CCCCCN2C(=O)c2ccc(C(N)=O)cn2)cc1 |
| InChI | InChI=1S/C20H23N3O3/c1-26-16-9-6-14(7-10-16)18-5-3-2-4-12-23(18)20(25)17-11-8-15(13-22-17)19(21)24/h6-11,13,18H,2-5,12H2,1H3,(H2,21,24)/t18-/m0/s1 |
| InChIKey | LYWLCFQEMCDIQC-SFHVURJKSA-N |
| XLogP | 2.95 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |