About 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide
2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide (PubChem CID 95043478) has the molecular formula C19H15N3O2S
and a molecular weight of 349.42 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 95043478 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1cnc(-c2noc3ccccc23)s1 |
| InChI | InChI=1S/C19H15N3O2S/c23-18(20-11-10-13-6-2-1-3-7-13)16-12-21-19(25-16)17-14-8-4-5-9-15(14)24-22-17/h1-9,12H,10-11H2,(H,20,23) |
| InChIKey | HRAOXIPZIMLRCU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide (CID 95043478) is 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide is O=C(NCCc1ccccc1)c1cnc(-c2noc3ccccc23)s1.
What is the InChIKey of 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide?
The InChIKey is HRAOXIPZIMLRCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O2S/c23-18(20-11-10-13-6-2-1-3-7-13)16-12-21-19(25-16)17-14-8-4-5-9-15(14)24-22-17/h1-9,12H,10-11H2,(H,20,23).
What are the key properties of 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide?
2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide has a molecular weight of 349.42 g/mol, XLogP of 3.92, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-benzoxazol-3-yl)-N-(2-phenylethyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 95043478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).