C16H23F3N4 — CID 95043512
1-[(3aR,4R,7aS)-2-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]-N,N-dimethylmethanamine (PubChem CID 95043512) has the molecular formula C16H23F3N4 and a molecular weight of 328.38 g/mol. Its IUPAC name is 1-[(3aR,4R,7aS)-2-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(3aR,4R,7aS)-2-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 95043512 |
| Molecular Formula | C16H23F3N4 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-[(3aR,4R,7aS)-2-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@@H]1CCC[C@@H]2CN(c3nccc(C(F)(F)F)n3)C[C@@H]21 |
| InChI | InChI=1S/C16H23F3N4/c1-22(2)8-11-4-3-5-12-9-23(10-13(11)12)15-20-7-6-14(21-15)16(17,18)19/h6-7,11-13H,3-5,8-10H2,1-2H3/t11-,12+,13+/m0/s1 |
| InChIKey | GTHWMSNHYGWFEL-YNEHKIRRSA-N |
| XLogP | 2.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |