C19H24N2O4 — CID 95044155
(1R,6S)-6-[[3-(butanoylamino)-2-methylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 95044155) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1R,6S)-6-[[3-(butanoylamino)-2-methylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6S)-6-[[3-(butanoylamino)-2-methylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 95044155 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (1R,6S)-6-[[3-(butanoylamino)-2-methylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCC(=O)Nc1cccc(NC(=O)[C@H]2CC=CC[C@H]2C(=O)O)c1C |
| InChI | InChI=1S/C19H24N2O4/c1-3-7-17(22)20-15-10-6-11-16(12(15)2)21-18(23)13-8-4-5-9-14(13)19(24)25/h4-6,10-11,13-14H,3,7-9H2,1-2H3,(H,20,22)(H,21,23)(H,24,25)/t13-,14+/m0/s1 |
| InChIKey | XQFGWKKVCJNYIX-UONOGXRCSA-N |
| XLogP | 3.34 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|