About 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide
4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 95044284) has the molecular formula C19H16F2N2OS2
and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide.
Molecular Properties
| Compound Name | 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide |
| PubChem CID | 95044284 |
| Molecular Formula | C19H16F2N2OS2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | C[C@H](SCc1csc(-c2ccc(C(N)=O)cc2)n1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H16F2N2OS2/c1-11(14-6-7-16(20)17(21)8-14)25-9-15-10-26-19(23-15)13-4-2-12(3-5-13)18(22)24/h2-8,10-11H,9H2,1H3,(H2,22,24)/t11-/m0/s1 |
| InChIKey | MMHDRJXNGLHHQT-NSHDSACASA-N |
| XLogP | 5.18 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide?
The IUPAC name of 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide (CID 95044284) is 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide.
What is the SMILES notation for 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide?
The canonical SMILES for 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide is C[C@H](SCc1csc(-c2ccc(C(N)=O)cc2)n1)c1ccc(F)c(F)c1.
What is the InChIKey of 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide?
The InChIKey is MMHDRJXNGLHHQT-NSHDSACASA-N. The full InChI is InChI=1S/C19H16F2N2OS2/c1-11(14-6-7-16(20)17(21)8-14)25-9-15-10-26-19(23-15)13-4-2-12(3-5-13)18(22)24/h2-8,10-11H,9H2,1H3,(H2,22,24)/t11-/m0/s1.
What are the key properties of 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide?
4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide has a molecular weight of 390.48 g/mol, XLogP of 5.18, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]sulfanylmethyl]-1,3-thiazol-2-yl]benzamide is sourced from PubChem (CID 95044284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).