C20H26N2O2 — CID 95045864
N,2,8-trimethyl-N-[2-[(2R)-oxan-2-yl]ethyl]quinoline-4-carboxamide (PubChem CID 95045864) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is N,2,8-trimethyl-N-[2-[(2R)-oxan-2-yl]ethyl]quinoline-4-carboxamide.
| Compound Name | N,2,8-trimethyl-N-[2-[(2R)-oxan-2-yl]ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 95045864 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N,2,8-trimethyl-N-[2-[(2R)-oxan-2-yl]ethyl]quinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)CC[C@H]2CCCCO2)c2cccc(C)c2n1 |
| InChI | InChI=1S/C20H26N2O2/c1-14-7-6-9-17-18(13-15(2)21-19(14)17)20(23)22(3)11-10-16-8-4-5-12-24-16/h6-7,9,13,16H,4-5,8,10-12H2,1-3H3/t16-/m1/s1 |
| InChIKey | VICKKZAYFVSFGU-MRXNPFEDSA-N |
| XLogP | 3.88 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |