C14H16N4O — CID 95046386
1-[(1S)-1-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]pyrrolidin-2-one (PubChem CID 95046386) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-[(1S)-1-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]pyrrolidin-2-one.
| Compound Name | 1-[(1S)-1-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 95046386 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-[(1S)-1-(3-phenyl-1H-1,2,4-triazol-5-yl)ethyl]pyrrolidin-2-one |
| SMILES | C[C@@H](c1nc(-c2ccccc2)n[nH]1)N1CCCC1=O |
| InChI | InChI=1S/C14H16N4O/c1-10(18-9-5-8-12(18)19)13-15-14(17-16-13)11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3,(H,15,16,17)/t10-/m0/s1 |
| InChIKey | YWOZJBZYVLSGTP-JTQLQIEISA-N |
| XLogP | 2.16 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |