C19H18N6O2 — CID 95047521
(5R)-5-[2-[2-(2-methyl-4-pyridinyl)-5-phenyl-1,2,4-triazol-3-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 95047521) has the molecular formula C19H18N6O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is (5R)-5-[2-[2-(2-methyl-4-pyridinyl)-5-phenyl-1,2,4-triazol-3-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[2-(2-methyl-4-pyridinyl)-5-phenyl-1,2,4-triazol-3-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95047521 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (5R)-5-[2-[2-(2-methyl-4-pyridinyl)-5-phenyl-1,2,4-triazol-3-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(-n2nc(-c3ccccc3)nc2CC[C@H]2NC(=O)NC2=O)ccn1 |
| InChI | InChI=1S/C19H18N6O2/c1-12-11-14(9-10-20-12)25-16(8-7-15-18(26)23-19(27)21-15)22-17(24-25)13-5-3-2-4-6-13/h2-6,9-11,15H,7-8H2,1H3,(H2,21,23,26,27)/t15-/m1/s1 |
| InChIKey | JVUJIYFJHVISCP-OAHLLOKOSA-N |
| XLogP | 1.78 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|