C20H20N2O2S — CID 95047719
N-[(1R)-2-methyl-1-phenylpropyl]-2-oxo-6-thiophen-2-yl-1H-pyridine-3-carboxamide (PubChem CID 95047719) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-[(1R)-2-methyl-1-phenylpropyl]-2-oxo-6-thiophen-2-yl-1H-pyridine-3-carboxamide.
| Compound Name | N-[(1R)-2-methyl-1-phenylpropyl]-2-oxo-6-thiophen-2-yl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95047719 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[(1R)-2-methyl-1-phenylpropyl]-2-oxo-6-thiophen-2-yl-1H-pyridine-3-carboxamide |
| SMILES | CC(C)[C@@H](NC(=O)c1ccc(-c2cccs2)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O2S/c1-13(2)18(14-7-4-3-5-8-14)22-20(24)15-10-11-16(21-19(15)23)17-9-6-12-25-17/h3-13,18H,1-2H3,(H,21,23)(H,22,24)/t18-/m1/s1 |
| InChIKey | PICNYVMZYCSASB-GOSISDBHSA-N |
| XLogP | 4.23 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |