About N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide
N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide (PubChem CID 950484) has the molecular formula C14H13N3O2S
and a molecular weight of 287.34 g/mol. Its IUPAC name is N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide |
| PubChem CID | 950484 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C14H13N3O2S/c1-20(18,19)16-12-6-4-5-11(9-12)13-10-17-8-3-2-7-14(17)15-13/h2-10,16H,1H3 |
| InChIKey | HZTCRXABMFMGTA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide?
The IUPAC name of N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide (CID 950484) is N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide.
What is the SMILES notation for N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide?
The canonical SMILES for N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide is CS(=O)(=O)Nc1cccc(-c2cn3ccccc3n2)c1.
What is the InChIKey of N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide?
The InChIKey is HZTCRXABMFMGTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2S/c1-20(18,19)16-12-6-4-5-11(9-12)13-10-17-8-3-2-7-14(17)15-13/h2-10,16H,1H3.
What are the key properties of N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide?
N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide has a molecular weight of 287.34 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)methanesulfonamide is sourced from PubChem (CID 950484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).