C16H20FN3O2 — CID 95048524
3-[3-[(2R)-2-(4-fluorophenyl)pyrrolidin-1-yl]propyl]imidazolidine-2,4-dione (PubChem CID 95048524) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 3-[3-[(2R)-2-(4-fluorophenyl)pyrrolidin-1-yl]propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[(2R)-2-(4-fluorophenyl)pyrrolidin-1-yl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95048524 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 3-[3-[(2R)-2-(4-fluorophenyl)pyrrolidin-1-yl]propyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCCN1CCC[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FN3O2/c17-13-6-4-12(5-7-13)14-3-1-8-19(14)9-2-10-20-15(21)11-18-16(20)22/h4-7,14H,1-3,8-11H2,(H,18,22)/t14-/m1/s1 |
| InChIKey | WTMNANSOGUJDGL-CQSZACIVSA-N |
| XLogP | 1.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|