C24H27NO6 — CID 95048681
(2R,4S)-2-tert-butyl-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid (PubChem CID 95048681) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is (2R,4S)-2-tert-butyl-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid.
| Compound Name | (2R,4S)-2-tert-butyl-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 95048681 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (2R,4S)-2-tert-butyl-4-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid |
| SMILES | CC(C)(C)[C@@H](C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H27NO6/c1-24(2,3)19(21(26)27)12-20(22(28)29)25-23(30)31-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-20H,12-13H2,1-3H3,(H,25,30)(H,26,27)(H,28,29)/t19-,20-/m0/s1 |
| InChIKey | FNRRRFVUTMRVEZ-PMACEKPBSA-N |
| XLogP | 4.12 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |