C8H11Cl2F3 — CID 95049167
[(1S)-1,2-dichloro-1,2,2-trifluoroethyl]cyclohexane (PubChem CID 95049167) has the molecular formula C8H11Cl2F3 and a molecular weight of 235.08 g/mol. Its IUPAC name is [(1S)-1,2-dichloro-1,2,2-trifluoroethyl]cyclohexane.
| Compound Name | [(1S)-1,2-dichloro-1,2,2-trifluoroethyl]cyclohexane |
|---|---|
| PubChem CID | 95049167 |
| Molecular Formula | C8H11Cl2F3 |
| Molecular Weight | 235.08 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | [(1S)-1,2-dichloro-1,2,2-trifluoroethyl]cyclohexane |
| SMILES | FC(F)(Cl)[C@@](F)(Cl)C1CCCCC1 |
| InChI | InChI=1S/C8H11Cl2F3/c9-7(11,8(10,12)13)6-4-2-1-3-5-6/h6H,1-5H2/t7-/m1/s1 |
| InChIKey | NTMQOCVGFBDYTB-SSDOTTSWSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.08 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|