C18H21N3O3 — CID 95049623
2-[(2S)-2-(3,4-dimethylphenyl)pyrrolidin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)-2-oxoacetamide (PubChem CID 95049623) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-[(2S)-2-(3,4-dimethylphenyl)pyrrolidin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)-2-oxoacetamide.
| Compound Name | 2-[(2S)-2-(3,4-dimethylphenyl)pyrrolidin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 95049623 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-[(2S)-2-(3,4-dimethylphenyl)pyrrolidin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2CCC[C@H]2c2ccc(C)c(C)c2)no1 |
| InChI | InChI=1S/C18H21N3O3/c1-11-6-7-14(9-12(11)2)15-5-4-8-21(15)18(23)17(22)19-16-10-13(3)24-20-16/h6-7,9-10,15H,4-5,8H2,1-3H3,(H,19,20,22)/t15-/m0/s1 |
| InChIKey | ZBVTYMGOJAEZCL-HNNXBMFYSA-N |
| XLogP | 2.90 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|