C15H17NO3S2 — CID 95050814
N-[3-(methoxymethyl)phenyl]-4-methylsulfanylbenzenesulfonamide (PubChem CID 95050814) has the molecular formula C15H17NO3S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[3-(methoxymethyl)phenyl]-4-methylsulfanylbenzenesulfonamide.
| Compound Name | N-[3-(methoxymethyl)phenyl]-4-methylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 95050814 |
| Molecular Formula | C15H17NO3S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-[3-(methoxymethyl)phenyl]-4-methylsulfanylbenzenesulfonamide |
| SMILES | COCc1cccc(NS(=O)(=O)c2ccc(SC)cc2)c1 |
| InChI | InChI=1S/C15H17NO3S2/c1-19-11-12-4-3-5-13(10-12)16-21(17,18)15-8-6-14(20-2)7-9-15/h3-10,16H,11H2,1-2H3 |
| InChIKey | AOJIDSNOZZTDMM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |