C15H19N3O — CID 95051321
5-[(2S)-1-benzylpiperidin-2-yl]-3-methyl-1,2,4-oxadiazole (PubChem CID 95051321) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 5-[(2S)-1-benzylpiperidin-2-yl]-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-[(2S)-1-benzylpiperidin-2-yl]-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 95051321 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 5-[(2S)-1-benzylpiperidin-2-yl]-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc([C@@H]2CCCCN2Cc2ccccc2)n1 |
| InChI | InChI=1S/C15H19N3O/c1-12-16-15(19-17-12)14-9-5-6-10-18(14)11-13-7-3-2-4-8-13/h2-4,7-8,14H,5-6,9-11H2,1H3/t14-/m0/s1 |
| InChIKey | OUYKZZXDMZGZJS-AWEZNQCLSA-N |
| XLogP | 3.11 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |