C14H25N3O2 — CID 95051729
1-[(3R)-1-(cyclopentanecarbonyl)pyrrolidin-3-yl]-3-propan-2-ylurea (PubChem CID 95051729) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-[(3R)-1-(cyclopentanecarbonyl)pyrrolidin-3-yl]-3-propan-2-ylurea.
| Compound Name | 1-[(3R)-1-(cyclopentanecarbonyl)pyrrolidin-3-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 95051729 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 1-[(3R)-1-(cyclopentanecarbonyl)pyrrolidin-3-yl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N[C@@H]1CCN(C(=O)C2CCCC2)C1 |
| InChI | InChI=1S/C14H25N3O2/c1-10(2)15-14(19)16-12-7-8-17(9-12)13(18)11-5-3-4-6-11/h10-12H,3-9H2,1-2H3,(H2,15,16,19)/t12-/m1/s1 |
| InChIKey | HNXVPCTYOGTRQI-GFCCVEGCSA-N |
| XLogP | 1.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |