C20H25NO4 — CID 95052340
ethyl 2-[[(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]methyl]-1-benzofuran-3-carboxylate (PubChem CID 95052340) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is ethyl 2-[[(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]methyl]-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 2-[[(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]methyl]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 95052340 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | ethyl 2-[[(4aS,8aS)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]methyl]-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(CN2CCO[C@H]3CCCC[C@@H]32)oc2ccccc12 |
| InChI | InChI=1S/C20H25NO4/c1-2-23-20(22)19-14-7-3-5-9-16(14)25-18(19)13-21-11-12-24-17-10-6-4-8-15(17)21/h3,5,7,9,15,17H,2,4,6,8,10-13H2,1H3/t15-,17-/m0/s1 |
| InChIKey | IASAEEYNPIUAJF-RDJZCZTQSA-N |
| XLogP | 3.75 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |