C15H14F4N4 — CID 950538
4-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]aniline (PubChem CID 950538) has the molecular formula C15H14F4N4 and a molecular weight of 326.30 g/mol. Its IUPAC name is 4-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]aniline.
| Compound Name | 4-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 950538 |
| Molecular Formula | C15H14F4N4 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4-[4-(2,3,5,6-tetrafluoro-4-pyridinyl)piperazin-1-yl]aniline |
| SMILES | Nc1ccc(N2CCN(c3c(F)c(F)nc(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C15H14F4N4/c16-11-13(12(17)15(19)21-14(11)18)23-7-5-22(6-8-23)10-3-1-9(20)2-4-10/h1-4H,5-8,20H2 |
| InChIKey | VDXYEUYQWZCVFK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|