C19H21N3O2 — CID 95056070
(3S)-1-(4-ethylphenyl)-2-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 95056070) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is (3S)-1-(4-ethylphenyl)-2-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-ethylphenyl)-2-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95056070 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (3S)-1-(4-ethylphenyl)-2-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | CCc1ccc(N2CC[C@@H](C(=O)NCc3cccnc3)C2=O)cc1 |
| InChI | InChI=1S/C19H21N3O2/c1-2-14-5-7-16(8-6-14)22-11-9-17(19(22)24)18(23)21-13-15-4-3-10-20-12-15/h3-8,10,12,17H,2,9,11,13H2,1H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | NHRMJENKODSWND-KRWDZBQOSA-N |
| XLogP | 2.31 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|