C26H29N3O6S — CID 95058951
3-(3,5-dimethoxyphenyl)-5-[5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-3-methyl-1-benzofuran-2-yl]-1,2,4-oxadiazole (PubChem CID 95058951) has the molecular formula C26H29N3O6S and a molecular weight of 511.60 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-5-[5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-3-methyl-1-benzofuran-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(3,5-dimethoxyphenyl)-5-[5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-3-methyl-1-benzofuran-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 95058951 |
| Molecular Formula | C26H29N3O6S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-5-[5-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-3-methyl-1-benzofuran-2-yl]-1,2,4-oxadiazole |
| SMILES | COc1cc(OC)cc(-c2noc(-c3oc4ccc(S(=O)(=O)N5C[C@H](C)C[C@@H](C)C5)cc4c3C)n2)c1 |
| InChI | InChI=1S/C26H29N3O6S/c1-15-8-16(2)14-29(13-15)36(30,31)21-6-7-23-22(12-21)17(3)24(34-23)26-27-25(28-35-26)18-9-19(32-4)11-20(10-18)33-5/h6-7,9-12,15-16H,8,13-14H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | DJQDDQGBDZXLDU-HZPDHXFCSA-N |
| XLogP | 5.14 |
| TPSA | 107.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |