C25H26ClN3O4 — CID 95063389
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(10S)-5-chloro-10-ethyl-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-2-yl]methanone (PubChem CID 95063389) has the molecular formula C25H26ClN3O4 and a molecular weight of 467.95 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(10S)-5-chloro-10-ethyl-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-2-yl]methanone.
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(10S)-5-chloro-10-ethyl-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-2-yl]methanone |
|---|---|
| PubChem CID | 95063389 |
| Molecular Formula | C25H26ClN3O4 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-[(10S)-5-chloro-10-ethyl-9-oxa-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-2-yl]methanone |
| SMILES | CC[C@H]1Cn2c(C(=O)N3CCN(Cc4ccc5c(c4)OCO5)CC3)cc3c(Cl)ccc(c32)O1 |
| InChI | InChI=1S/C25H26ClN3O4/c1-2-17-14-29-20(12-18-19(26)4-6-22(33-17)24(18)29)25(30)28-9-7-27(8-10-28)13-16-3-5-21-23(11-16)32-15-31-21/h3-6,11-12,17H,2,7-10,13-15H2,1H3/t17-/m0/s1 |
| InChIKey | HIHUXZBUNOJDBH-KRWDZBQOSA-N |
| XLogP | 4.15 |
| TPSA | 56.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |