C12H25N3O2 — CID 95067014
(2S)-1-(1,4-diazepan-1-yl)-3-morpholin-4-ylpropan-2-ol (PubChem CID 95067014) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is (2S)-1-(1,4-diazepan-1-yl)-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2S)-1-(1,4-diazepan-1-yl)-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 95067014 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | (2S)-1-(1,4-diazepan-1-yl)-3-morpholin-4-ylpropan-2-ol |
| SMILES | O[C@@H](CN1CCCNCC1)CN1CCOCC1 |
| InChI | InChI=1S/C12H25N3O2/c16-12(11-15-6-8-17-9-7-15)10-14-4-1-2-13-3-5-14/h12-13,16H,1-11H2/t12-/m0/s1 |
| InChIKey | MIJIWGLPVCQNMD-LBPRGKRZSA-N |
| XLogP | -1.03 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |