C23H25ClFN3O3 — CID 95067133
(2R)-N-[2-(4-chlorophenyl)ethyl]-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide (PubChem CID 95067133) has the molecular formula C23H25ClFN3O3 and a molecular weight of 445.92 g/mol. Its IUPAC name is (2R)-N-[2-(4-chlorophenyl)ethyl]-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide.
| Compound Name | (2R)-N-[2-(4-chlorophenyl)ethyl]-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide |
|---|---|
| PubChem CID | 95067133 |
| Molecular Formula | C23H25ClFN3O3 |
| Molecular Weight | 445.92 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (2R)-N-[2-(4-chlorophenyl)ethyl]-2-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide |
| SMILES | CC[C@H](C(=O)NCCc1ccc(Cl)cc1)N1CCN(Cc2ccc(F)cc2)C(=O)C1=O |
| InChI | InChI=1S/C23H25ClFN3O3/c1-2-20(21(29)26-12-11-16-3-7-18(24)8-4-16)28-14-13-27(22(30)23(28)31)15-17-5-9-19(25)10-6-17/h3-10,20H,2,11-15H2,1H3,(H,26,29)/t20-/m1/s1 |
| InChIKey | GHOPWFLWLVJPEX-HXUWFJFHSA-N |
| XLogP | 2.79 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.92 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|