About (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one
(4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one (PubChem CID 950685) has the molecular formula C13H12F2O
and a molecular weight of 222.23 g/mol. Its IUPAC name is (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one |
| PubChem CID | 950685 |
| Molecular Formula | C13H12F2O |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one |
| SMILES | CC1=C[C@@H](c2ccc(F)cc2F)CCC1=O |
| InChI | InChI=1S/C13H12F2O/c1-8-6-9(2-5-13(8)16)11-4-3-10(14)7-12(11)15/h3-4,6-7,9H,2,5H2,1H3/t9-/m0/s1 |
| InChIKey | ISBSPZZMLDCRCS-VIFPVBQESA-N |
| XLogP | 3.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one?
The IUPAC name of (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one (CID 950685) is (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one.
What is the SMILES notation for (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one?
The canonical SMILES for (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one is CC1=C[C@@H](c2ccc(F)cc2F)CCC1=O.
What is the InChIKey of (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one?
The InChIKey is ISBSPZZMLDCRCS-VIFPVBQESA-N. The full InChI is InChI=1S/C13H12F2O/c1-8-6-9(2-5-13(8)16)11-4-3-10(14)7-12(11)15/h3-4,6-7,9H,2,5H2,1H3/t9-/m0/s1.
What are the key properties of (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one?
(4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one has a molecular weight of 222.23 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(2,4-difluorophenyl)-2-methylcyclohex-2-en-1-one is sourced from PubChem (CID 950685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).