C23H35N5O4S — CID 95074619
(6aR)-N,N-diethyl-5-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-sulfonamide (PubChem CID 95074619) has the molecular formula C23H35N5O4S and a molecular weight of 477.63 g/mol. Its IUPAC name is (6aR)-N,N-diethyl-5-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-sulfonamide.
| Compound Name | (6aR)-N,N-diethyl-5-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-sulfonamide |
|---|---|
| PubChem CID | 95074619 |
| Molecular Formula | C23H35N5O4S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | (6aR)-N,N-diethyl-5-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)N(CC(=O)N1CCN(C)CC1)C(=O)[C@H]1CCCCN21 |
| InChI | InChI=1S/C23H35N5O4S/c1-4-26(5-2)33(31,32)18-9-10-19-21(16-18)28(23(30)20-8-6-7-11-27(19)20)17-22(29)25-14-12-24(3)13-15-25/h9-10,16,20H,4-8,11-15,17H2,1-3H3/t20-/m1/s1 |
| InChIKey | SOYBWMBBGAMRHU-HXUWFJFHSA-N |
| XLogP | 1.20 |
| TPSA | 84.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |