C15H27N3S — CID 950747
1,5-dicyclohexyl-1,3,5-triazinane-2-thione (PubChem CID 950747) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is 1,5-dicyclohexyl-1,3,5-triazinane-2-thione.
| Compound Name | 1,5-dicyclohexyl-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 950747 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1,5-dicyclohexyl-1,3,5-triazinane-2-thione |
| SMILES | S=C1NCN(C2CCCCC2)CN1C1CCCCC1 |
| InChI | InChI=1S/C15H27N3S/c19-15-16-11-17(13-7-3-1-4-8-13)12-18(15)14-9-5-2-6-10-14/h13-14H,1-12H2,(H,16,19) |
| InChIKey | OKSWZNASDVVMHM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|